About prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate
prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate (PubChem CID 157438883) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate |
| PubChem CID | 157438883 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate |
| SMILES | C=CC.CCCOC(=O)C1CCCCC1C(=O)OOC |
| InChI | InChI=1S/C12H20O5.C3H6/c1-3-8-16-11(13)9-6-4-5-7-10(9)12(14)17-15-2;1-3-2/h9-10H,3-8H2,1-2H3;3H,1H2,2H3 |
| InChIKey | BRKUUJZPLMPBML-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The IUPAC name of prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate (CID 157438883) is prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate.
What is the SMILES notation for prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The canonical SMILES for prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate is C=CC.CCCOC(=O)C1CCCCC1C(=O)OOC.
What is the InChIKey of prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
The InChIKey is BRKUUJZPLMPBML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5.C3H6/c1-3-8-16-11(13)9-6-4-5-7-10(9)12(14)17-15-2;1-3-2/h9-10H,3-8H2,1-2H3;3H,1H2,2H3.
What are the key properties of prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate?
prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate has a molecular weight of 286.37 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;propyl 2-methylperoxycarbonylcyclohexane-1-carboxylate is sourced from PubChem (CID 157438883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).