C19H35NO5 — CID 164933306
1-O-[2-(dipropylamino)ethyl] 2-O-(2-methoxyethyl) cyclohexane-1,2-dicarboxylate (PubChem CID 164933306) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-O-[2-(dipropylamino)ethyl] 2-O-(2-methoxyethyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(dipropylamino)ethyl] 2-O-(2-methoxyethyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164933306 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 1-O-[2-(dipropylamino)ethyl] 2-O-(2-methoxyethyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CCCN(CCC)CCOC(=O)C1CCCCC1C(=O)OCCOC |
| InChI | InChI=1S/C19H35NO5/c1-4-10-20(11-5-2)12-13-24-18(21)16-8-6-7-9-17(16)19(22)25-15-14-23-3/h16-17H,4-15H2,1-3H3 |
| InChIKey | MAJHVCAGCFMGNR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|