C22H42O5Si — CID 174556828
3-[1,1,2-triethoxy-2-(2-methylpropyl)silinan-3-yl]propyl 2-methylprop-2-enoate (PubChem CID 174556828) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 3-[1,1,2-triethoxy-2-(2-methylpropyl)silinan-3-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[1,1,2-triethoxy-2-(2-methylpropyl)silinan-3-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174556828 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 3-[1,1,2-triethoxy-2-(2-methylpropyl)silinan-3-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1CCC[Si](OCC)(OCC)C1(CC(C)C)OCC |
| InChI | InChI=1S/C22H42O5Si/c1-8-25-22(17-18(4)5)20(13-11-15-24-21(23)19(6)7)14-12-16-28(22,26-9-2)27-10-3/h18,20H,6,8-17H2,1-5,7H3 |
| InChIKey | JVYOFICBHLBCJA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|