C17H33NO4Si — CID 142737743
8-ethenyl-6-(2-ethoxyethyl)-2,2-dimethoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737743) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is 8-ethenyl-6-(2-ethoxyethyl)-2,2-dimethoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 8-ethenyl-6-(2-ethoxyethyl)-2,2-dimethoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737743 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 8-ethenyl-6-(2-ethoxyethyl)-2,2-dimethoxy-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | C=CC1CCC2O[Si](OC)(OC)CCCN(CCOCC)C2C1 |
| InChI | InChI=1S/C17H33NO4Si/c1-5-15-8-9-17-16(14-15)18(11-12-21-6-2)10-7-13-23(19-3,20-4)22-17/h5,15-17H,1,6-14H2,2-4H3 |
| InChIKey | WXCUODXLBUQAHD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|