C17H35NO4Si — CID 142737771
2,2-dimethoxy-6-(3-propan-2-yloxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine (PubChem CID 142737771) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is 2,2-dimethoxy-6-(3-propan-2-yloxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine.
| Compound Name | 2,2-dimethoxy-6-(3-propan-2-yloxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
|---|---|
| PubChem CID | 142737771 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 2,2-dimethoxy-6-(3-propan-2-yloxypropyl)-4,5,6a,7,8,9,10,10a-octahydro-3H-benzo[g][1,6,2]oxazasilocine |
| SMILES | CO[Si]1(OC)CCCN(CCCOC(C)C)C2CCCCC2O1 |
| InChI | InChI=1S/C17H35NO4Si/c1-15(2)21-13-7-11-18-12-8-14-23(19-3,20-4)22-17-10-6-5-9-16(17)18/h15-17H,5-14H2,1-4H3 |
| InChIKey | RVNCDKUHFBWCJT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|