C12H28O2SSi2 — CID 150733885
2-methoxy-2,7,7,8,8-pentamethyl-1,6,2,7-oxathiadisilecane (PubChem CID 150733885) has the molecular formula C12H28O2SSi2 and a molecular weight of 292.59 g/mol. Its IUPAC name is 2-methoxy-2,7,7,8,8-pentamethyl-1,6,2,7-oxathiadisilecane.
| Compound Name | 2-methoxy-2,7,7,8,8-pentamethyl-1,6,2,7-oxathiadisilecane |
|---|---|
| PubChem CID | 150733885 |
| Molecular Formula | C12H28O2SSi2 |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-methoxy-2,7,7,8,8-pentamethyl-1,6,2,7-oxathiadisilecane |
| SMILES | CO[Si]1(C)CCCS[Si](C)(C)C(C)(C)CCO1 |
| InChI | InChI=1S/C12H28O2SSi2/c1-12(2)8-9-14-17(6,13-3)11-7-10-15-16(12,4)5/h7-11H2,1-6H3 |
| InChIKey | JSKISOBFIYNULO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|