C14H24F18O7Si7 — CID 159409910
2,2,4,4,6,6-hexakis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 159409910) has the molecular formula C14H24F18O7Si7 and a molecular weight of 842.90 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4,6,6-hexakis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 159409910 |
| Molecular Formula | C14H24F18O7Si7 |
| Molecular Weight | 842.90 g/mol |
| Exact Mass | 841.96 |
| IUPAC Name | 2,2,4,4,6,6-hexakis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1.FC(F)(F)[Si]1(C(F)(F)F)O[Si](C(F)(F)F)(C(F)(F)F)O[Si](C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H24O4Si4.C6F18O3Si3/c1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13;7-1(8,9)28(2(10,11)12)25-29(3(13,14)15,4(16,17)18)27-30(26-28,5(19,20)21)6(22,23)24/h1-8H3; |
| InChIKey | LOLIMFVACWUGQZ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.90 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|