C7H19O3Si3 — CID 20607903
CID 20607903 (PubChem CID 20607903) has the molecular formula C7H19O3Si3 and a molecular weight of 235.48 g/mol.
| Compound Name | CID 20607903 |
|---|---|
| PubChem CID | 20607903 |
| Molecular Formula | C7H19O3Si3 |
| Molecular Weight | 235.48 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | — |
| SMILES | C[Si]1O[Si](C)(C)CCO[Si](C)(C)O1 |
| InChI | InChI=1S/C7H19O3Si3/c1-11-9-12(2,3)7-6-8-13(4,5)10-11/h6-7H2,1-5H3 |
| InChIKey | DLICRRLNAKIXCB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|