C7H19O3Si3 — CID 59953178
CID 59953178 (PubChem CID 59953178) has the molecular formula C7H19O3Si3 and a molecular weight of 235.48 g/mol.
| Compound Name | CID 59953178 |
|---|---|
| PubChem CID | 59953178 |
| Molecular Formula | C7H19O3Si3 |
| Molecular Weight | 235.48 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | — |
| SMILES | C[Si]1CCCO[SiH](C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C7H19O3Si3/c1-11-7-5-6-8-12(2)10-13(3,4)9-11/h12H,5-7H2,1-4H3 |
| InChIKey | MQQSVVBRZLJAJM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|