C16H36O4Si4 — CID 175419281
2,6-dicyclohexyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 175419281) has the molecular formula C16H36O4Si4 and a molecular weight of 404.80 g/mol. Its IUPAC name is 2,6-dicyclohexyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,6-dicyclohexyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 175419281 |
| Molecular Formula | C16H36O4Si4 |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2,6-dicyclohexyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[Si](C)(C2CCCCC2)O[SiH](C)O[Si](C)(C2CCCCC2)O1 |
| InChI | InChI=1S/C16H36O4Si4/c1-21-17-23(3,15-11-7-5-8-12-15)19-22(2)20-24(4,18-21)16-13-9-6-10-14-16/h15-16,21-22H,5-14H2,1-4H3 |
| InChIKey | FREXJKBPFCHWBW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|