C36H80O6Si7 — CID 151702906
tri(cyclodecyl)-(2,4,4,6,6,8-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)silane (PubChem CID 151702906) has the molecular formula C36H80O6Si7 and a molecular weight of 805.63 g/mol. Its IUPAC name is tri(cyclodecyl)-(2,4,4,6,6,8-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)silane.
| Compound Name | tri(cyclodecyl)-(2,4,4,6,6,8-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)silane |
|---|---|
| PubChem CID | 151702906 |
| Molecular Formula | C36H80O6Si7 |
| Molecular Weight | 805.63 g/mol |
| Exact Mass | 804.43 |
| IUPAC Name | tri(cyclodecyl)-(2,4,4,6,6,8-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)silane |
| SMILES | C[SiH]1O[SiH2]O[SiH2]O[Si](C)([Si](C2CCCCCCCCC2)(C2CCCCCCCCC2)C2CCCCCCCCC2)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C36H80O6Si7/c1-45-38-43-37-44-39-48(6,42-47(4,5)41-46(2,3)40-45)49(34-28-22-16-10-7-11-17-23-29-34,35-30-24-18-12-8-13-19-25-31-35)36-32-26-20-14-9-15-21-27-33-36/h34-36,45H,7-33,43-44H2,1-6H3 |
| InChIKey | REZDPMYWEKHDTK-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.63 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|