C14H35NO4Si4 — CID 151250646
N-(cyclohexylmethyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 151250646) has the molecular formula C14H35NO4Si4 and a molecular weight of 393.78 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N-(cyclohexylmethyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 151250646 |
| Molecular Formula | C14H35NO4Si4 |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(cyclohexylmethyl)-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(NCC2CCCCC2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C14H35NO4Si4/c1-20(2)16-21(3,4)18-23(7,19-22(5,6)17-20)15-13-14-11-9-8-10-12-14/h14-15H,8-13H2,1-7H3 |
| InChIKey | NSGGTEWBCYRVQO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|