C12H29NO3Si3 — CID 151203670
N-(cyclohexylmethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine (PubChem CID 151203670) has the molecular formula C12H29NO3Si3 and a molecular weight of 319.63 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine.
| Compound Name | N-(cyclohexylmethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
|---|---|
| PubChem CID | 151203670 |
| Molecular Formula | C12H29NO3Si3 |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-(cyclohexylmethyl)-2,4,4,6,6-pentamethyl-1,3,5,2,4,6-trioxatrisilinan-2-amine |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(NCC2CCCCC2)O1 |
| InChI | InChI=1S/C12H29NO3Si3/c1-17(2)14-18(3,4)16-19(5,15-17)13-11-12-9-7-6-8-10-12/h12-13H,6-11H2,1-5H3 |
| InChIKey | NIVHTVUWFVVUSY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|