C21H42O8Si — CID 163773600
2-cyclohexyl-2-methyl-1,3,6,9,12,15,18,21-octaoxa-2-silacyclotricosane (PubChem CID 163773600) has the molecular formula C21H42O8Si and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-cyclohexyl-2-methyl-1,3,6,9,12,15,18,21-octaoxa-2-silacyclotricosane.
| Compound Name | 2-cyclohexyl-2-methyl-1,3,6,9,12,15,18,21-octaoxa-2-silacyclotricosane |
|---|---|
| PubChem CID | 163773600 |
| Molecular Formula | C21H42O8Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-cyclohexyl-2-methyl-1,3,6,9,12,15,18,21-octaoxa-2-silacyclotricosane |
| SMILES | C[Si]1(C2CCCCC2)OCCOCCOCCOCCOCCOCCOCCO1 |
| InChI | InChI=1S/C21H42O8Si/c1-30(21-5-3-2-4-6-21)28-19-17-26-15-13-24-11-9-22-7-8-23-10-12-25-14-16-27-18-20-29-30/h21H,2-20H2,1H3 |
| InChIKey | IGMATYSTXBHWJN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|