C36H66O3Si3 — CID 140681788
2,2,4,4,6,6-hexacyclohexyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 140681788) has the molecular formula C36H66O3Si3 and a molecular weight of 631.18 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexacyclohexyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexacyclohexyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 140681788 |
| Molecular Formula | C36H66O3Si3 |
| Molecular Weight | 631.18 g/mol |
| Exact Mass | 630.43 |
| IUPAC Name | 2,2,4,4,6,6-hexacyclohexyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C1CCC([Si]2(C3CCCCC3)O[Si](C3CCCCC3)(C3CCCCC3)O[Si](C3CCCCC3)(C3CCCCC3)O2)CC1 |
| InChI | InChI=1S/C36H66O3Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32)37-41(33-23-11-3-12-24-33,34-25-13-4-14-26-34)39-42(38-40,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h31-36H,1-30H2 |
| InChIKey | KSHXMBZGEVBSTC-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.18 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|