C33H66O6Si3 — CID 68656094
2,4,6-tricyclohexyl-2,4,6-tris[(2-methylpropan-2-yl)oxymethyl]-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 68656094) has the molecular formula C33H66O6Si3 and a molecular weight of 643.14 g/mol. Its IUPAC name is 2,4,6-tricyclohexyl-2,4,6-tris[(2-methylpropan-2-yl)oxymethyl]-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-tricyclohexyl-2,4,6-tris[(2-methylpropan-2-yl)oxymethyl]-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 68656094 |
| Molecular Formula | C33H66O6Si3 |
| Molecular Weight | 643.14 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | 2,4,6-tricyclohexyl-2,4,6-tris[(2-methylpropan-2-yl)oxymethyl]-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CC(C)(C)OC[Si]1(C2CCCCC2)O[Si](COC(C)(C)C)(C2CCCCC2)O[Si](COC(C)(C)C)(C2CCCCC2)O1 |
| InChI | InChI=1S/C33H66O6Si3/c1-31(2,3)34-25-40(28-19-13-10-14-20-28)37-41(26-35-32(4,5)6,29-21-15-11-16-22-29)39-42(38-40,27-36-33(7,8)9)30-23-17-12-18-24-30/h28-30H,10-27H2,1-9H3 |
| InChIKey | MXBQWHLBJNQIQP-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.14 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|