C45H86O11Si8 — CID 101363185
(1,3,5,7,9,11,13-heptacyclohexyl-2,4,6,8,10,12,14,15,16,17-decaoxa-1,3,5,7,9,11,13-heptasilatetracyclo[7.5.1.13,7.15,11]heptadecan-13-yl)oxy-trimethylsilane (PubChem CID 101363185) has the molecular formula C45H86O11Si8 and a molecular weight of 1027.86 g/mol. Its IUPAC name is (1,3,5,7,9,11,13-heptacyclohexyl-2,4,6,8,10,12,14,15,16,17-decaoxa-1,3,5,7,9,11,13-heptasilatetracyclo[7.5.1.13,7.15,11]heptadecan-13-yl)oxy-trimethylsilane.
| Compound Name | (1,3,5,7,9,11,13-heptacyclohexyl-2,4,6,8,10,12,14,15,16,17-decaoxa-1,3,5,7,9,11,13-heptasilatetracyclo[7.5.1.13,7.15,11]heptadecan-13-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 101363185 |
| Molecular Formula | C45H86O11Si8 |
| Molecular Weight | 1027.86 g/mol |
| Exact Mass | 1026.43 |
| IUPAC Name | (1,3,5,7,9,11,13-heptacyclohexyl-2,4,6,8,10,12,14,15,16,17-decaoxa-1,3,5,7,9,11,13-heptasilatetracyclo[7.5.1.13,7.15,11]heptadecan-13-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[Si]1(C2CCCCC2)O[Si]2(C3CCCCC3)O[Si]3(C4CCCCC4)O[Si](C4CCCCC4)(O1)O[Si]1(C4CCCCC4)O[Si](C4CCCCC4)(O2)O[Si](C2CCCCC2)(O3)O1 |
| InChI | InChI=1S/C45H86O11Si8/c1-57(2,3)46-58(39-25-11-4-12-26-39)47-59(40-27-13-5-14-28-40)49-61(42-31-17-7-18-32-42)50-60(48-58,41-29-15-6-16-30-41)52-63(44-35-21-9-22-36-44)54-62(51-59,43-33-19-8-20-34-43)55-64(53-61,56-63)45-37-23-10-24-38-45/h39-45H,4-38H2,1-3H3 |
| InChIKey | BSKXTMLZZRPFKX-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.86 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|