C44H84O12Si8 — CID 101363187
1,3,5,7,9,11,15-heptacyclohexyl-7-hydroxy-13,13-dimethyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecane (PubChem CID 101363187) has the molecular formula C44H84O12Si8 and a molecular weight of 1029.83 g/mol. Its IUPAC name is 1,3,5,7,9,11,15-heptacyclohexyl-7-hydroxy-13,13-dimethyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecane.
| Compound Name | 1,3,5,7,9,11,15-heptacyclohexyl-7-hydroxy-13,13-dimethyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecane |
|---|---|
| PubChem CID | 101363187 |
| Molecular Formula | C44H84O12Si8 |
| Molecular Weight | 1029.83 g/mol |
| Exact Mass | 1028.41 |
| IUPAC Name | 1,3,5,7,9,11,15-heptacyclohexyl-7-hydroxy-13,13-dimethyl-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecane |
| SMILES | C[Si]1(C)O[Si]2(C3CCCCC3)O[Si]3(C4CCCCC4)O[Si](O)(C4CCCCC4)O[Si]4(C5CCCCC5)O[Si](C5CCCCC5)(O1)O[Si](C1CCCCC1)(O2)O[Si](C1CCCCC1)(O3)O4 |
| InChI | InChI=1S/C44H84O12Si8/c1-57(2)46-59(39-26-12-4-13-27-39)50-61(41-30-16-6-17-31-41)48-58(45,38-24-10-3-11-25-38)49-62(42-32-18-7-19-33-42)51-60(47-57,40-28-14-5-15-29-40)53-63(52-59,43-34-20-8-21-35-43)56-64(54-61,55-62)44-36-22-9-23-37-44/h38-45H,3-37H2,1-2H3 |
| InChIKey | QRWHHCSQSGOQHI-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.83 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|