C45H81O12Si7Zr — CID 11286233
CID 11286233 (PubChem CID 11286233) has the molecular formula C45H81O12Si7Zr and a molecular weight of 1101.96 g/mol.
| Compound Name | CID 11286233 |
|---|---|
| PubChem CID | 11286233 |
| Molecular Formula | C45H81O12Si7Zr |
| Molecular Weight | 1101.96 g/mol |
| Exact Mass | 1099.32 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C](C)[C]1C.O[Si]1(C2CCCC2)O[Si]2(C3CCCC3)O[Si](O)(C3CCCC3)O[Si]3(C4CCCC4)O[Si](O)(C4CCCC4)O[Si](C4CCCC4)(O1)O[Si](C1CCCC1)(O2)O3.[Zr] |
| InChI | InChI=1S/C35H66O12Si7.C10H15.Zr/c36-48(29-15-1-2-16-29)39-51(32-21-7-8-22-32)41-49(37,30-17-3-4-18-30)43-53(34-25-11-12-26-34)44-50(38,31-19-5-6-20-31)42-52(40-48,33-23-9-10-24-33)46-54(45-51,47-53)35-27-13-14-28-35;1-6-7(2)9(4)10(5)8(6)3;/h29-38H,1-28H2;1-5H3; |
| InChIKey | FIJDEPYYKAFLPH-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.96 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|