About CID 11286233
CID 11286233 (PubChem CID 11286233) has the molecular formula C45H81O12Si7Zr
and a molecular weight of 1101.96 g/mol.
Molecular Properties
| Compound Name | CID 11286233 |
| PubChem CID | 11286233 |
| Molecular Formula | C45H81O12Si7Zr |
| Molecular Weight | 1101.96 g/mol |
| Exact Mass | 1099.32 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C](C)[C]1C.O[Si]1(C2CCCC2)O[Si]2(C3CCCC3)O[Si](O)(C3CCCC3)O[Si]3(C4CCCC4)O[Si](O)(C4CCCC4)O[Si](C4CCCC4)(O1)O[Si](C1CCCC1)(O2)O3.[Zr] |
| InChI | InChI=1S/C35H66O12Si7.C10H15.Zr/c36-48(29-15-1-2-16-29)39-51(32-21-7-8-22-32)41-49(37,30-17-3-4-18-30)43-53(34-25-11-12-26-34)44-50(38,31-19-5-6-20-31)42-52(40-48,33-23-9-10-24-33)46-54(45-51,47-53)35-27-13-14-28-35;1-6-7(2)9(4)10(5)8(6)3;/h29-38H,1-28H2;1-5H3; |
| InChIKey | FIJDEPYYKAFLPH-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1101.96 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11286233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11286233?
The IUPAC name of CID 11286233 (CID 11286233) is not available.
What is the SMILES notation for CID 11286233?
The canonical SMILES for CID 11286233 is C[C]1[C](C)[C](C)[C](C)[C]1C.O[Si]1(C2CCCC2)O[Si]2(C3CCCC3)O[Si](O)(C3CCCC3)O[Si]3(C4CCCC4)O[Si](O)(C4CCCC4)O[Si](C4CCCC4)(O1)O[Si](C1CCCC1)(O2)O3.[Zr].
What is the InChIKey of CID 11286233?
The InChIKey is FIJDEPYYKAFLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H66O12Si7.C10H15.Zr/c36-48(29-15-1-2-16-29)39-51(32-21-7-8-22-32)41-49(37,30-17-3-4-18-30)43-53(34-25-11-12-26-34)44-50(38,31-19-5-6-20-31)42-52(40-48,33-23-9-10-24-33)46-54(45-51,47-53)35-27-13-14-28-35;1-6-7(2)9(4)10(5)8(6)3;/h29-38H,1-28H2;1-5H3;.
What are the key properties of CID 11286233?
CID 11286233 has a molecular weight of 1101.96 g/mol, XLogP of 11.30, 7 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11286233 is sourced from PubChem (CID 11286233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).