C42H80O12Si7 — CID 4549737
1,3,5,7,9,11,14-heptacyclohexyl-3,7,14-trihydroxy-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane (PubChem CID 4549737) has the molecular formula C42H80O12Si7 and a molecular weight of 973.69 g/mol. Its IUPAC name is 1,3,5,7,9,11,14-heptacyclohexyl-3,7,14-trihydroxy-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane.
| Compound Name | 1,3,5,7,9,11,14-heptacyclohexyl-3,7,14-trihydroxy-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane |
|---|---|
| PubChem CID | 4549737 |
| Molecular Formula | C42H80O12Si7 |
| Molecular Weight | 973.69 g/mol |
| Exact Mass | 972.40 |
| IUPAC Name | 1,3,5,7,9,11,14-heptacyclohexyl-3,7,14-trihydroxy-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecane |
| SMILES | O[Si]1(C2CCCCC2)O[Si]2(C3CCCCC3)O[Si](O)(C3CCCCC3)O[Si]3(C4CCCCC4)O[Si](O)(C4CCCCC4)O[Si](C4CCCCC4)(O1)O[Si](C1CCCCC1)(O2)O3 |
| InChI | InChI=1S/C42H80O12Si7/c43-55(36-22-8-1-9-23-36)46-58(39-28-14-4-15-29-39)48-56(44,37-24-10-2-11-25-37)50-60(41-32-18-6-19-33-41)51-57(45,38-26-12-3-13-27-38)49-59(47-55,40-30-16-5-17-31-40)53-61(52-58,54-60)42-34-20-7-21-35-42/h36-45H,1-35H2 |
| InChIKey | GAUUYVMFTLBDED-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.69 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|