C17H25Cl3O2Si2 — CID 164816092
trichloro-[3-(2-cyclohexyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)propyl]silane (PubChem CID 164816092) has the molecular formula C17H25Cl3O2Si2 and a molecular weight of 423.92 g/mol. Its IUPAC name is trichloro-[3-(2-cyclohexyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)propyl]silane.
| Compound Name | trichloro-[3-(2-cyclohexyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)propyl]silane |
|---|---|
| PubChem CID | 164816092 |
| Molecular Formula | C17H25Cl3O2Si2 |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | trichloro-[3-(2-cyclohexyl-2-methyl-4H-1,3,2-benzodioxasilin-6-yl)propyl]silane |
| SMILES | C[Si]1(C2CCCCC2)OCc2cc(CCC[Si](Cl)(Cl)Cl)ccc2O1 |
| InChI | InChI=1S/C17H25Cl3O2Si2/c1-23(16-7-3-2-4-8-16)21-13-15-12-14(9-10-17(15)22-23)6-5-11-24(18,19)20/h9-10,12,16H,2-8,11,13H2,1H3 |
| InChIKey | QWQOFSPTPMFWGO-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|