C18H26ClNO — CID 65445563
N-(2-chloroethyl)-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]cyclohexanamine (PubChem CID 65445563) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]cyclohexanamine.
| Compound Name | N-(2-chloroethyl)-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 65445563 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-(2-chloroethyl)-N-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]cyclohexanamine |
| SMILES | ClCCN(CCc1ccc2c(c1)CCO2)C1CCCCC1 |
| InChI | InChI=1S/C18H26ClNO/c19-10-12-20(17-4-2-1-3-5-17)11-8-15-6-7-18-16(14-15)9-13-21-18/h6-7,14,17H,1-5,8-13H2 |
| InChIKey | CLYZQAFGDYJTNM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|