C18H24O2 — CID 114974294
1-cyclohexyl-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one (PubChem CID 114974294) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one.
| Compound Name | 1-cyclohexyl-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one |
|---|---|
| PubChem CID | 114974294 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-cyclohexyl-4-(2,3-dihydro-1-benzofuran-5-yl)butan-2-one |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)CC1CCCCC1 |
| InChI | InChI=1S/C18H24O2/c19-17(13-14-4-2-1-3-5-14)8-6-15-7-9-18-16(12-15)10-11-20-18/h7,9,12,14H,1-6,8,10-11,13H2 |
| InChIKey | OLTFGPUFBZESRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |