C17H23NO2 — CID 116559956
4-(2,3-dihydro-1-benzofuran-5-yl)-1-piperidin-4-ylbutan-2-one (PubChem CID 116559956) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-yl)-1-piperidin-4-ylbutan-2-one.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-1-piperidin-4-ylbutan-2-one |
|---|---|
| PubChem CID | 116559956 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-yl)-1-piperidin-4-ylbutan-2-one |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)CC1CCNCC1 |
| InChI | InChI=1S/C17H23NO2/c19-16(12-14-5-8-18-9-6-14)3-1-13-2-4-17-15(11-13)7-10-20-17/h2,4,11,14,18H,1,3,5-10,12H2 |
| InChIKey | YJLYPCYHKXWUNG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |