2-methyloxasilinane;silicic acid

C5H16O5Si2 — CID 173113818

IUPAC2-methyloxasilinane;silicic acid
SMILESC[SiH]1CCCCO1.O[Si](O)(O)O
InChIInChI=1S/C5H12OSi.H4O4Si/c1-7-5-3-2-4-6-7;1-5(2,3)4/h7H,2-5H2,1H3;1-4H
InChIKeyBDKPSSRIZWNZSN-UHFFFAOYSA-N
MW212.35 g/mol
LogP-1.46
Rot. Bonds

About 2-methyloxasilinane;silicic acid

2-methyloxasilinane;silicic acid (PubChem CID 173113818) has the molecular formula C5H16O5Si2 and a molecular weight of 212.35 g/mol. Its IUPAC name is 2-methyloxasilinane;silicic acid.

Molecular Properties

Compound Name2-methyloxasilinane;silicic acid
PubChem CID173113818
Molecular FormulaC5H16O5Si2
Molecular Weight212.35 g/mol
Exact Mass212.05
IUPAC Name2-methyloxasilinane;silicic acid
SMILESC[SiH]1CCCCO1.O[Si](O)(O)O
InChIInChI=1S/C5H12OSi.H4O4Si/c1-7-5-3-2-4-6-7;1-5(2,3)4/h7H,2-5H2,1H3;1-4H
InChIKeyBDKPSSRIZWNZSN-UHFFFAOYSA-N
XLogP-1.46
TPSA90.15 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.35
LogP ≤ 5-1.46
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-methyloxasilinane;silicic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyloxasilinane;silicic acid?
The IUPAC name of 2-methyloxasilinane;silicic acid (CID 173113818) is 2-methyloxasilinane;silicic acid.
What is the SMILES notation for 2-methyloxasilinane;silicic acid?
The canonical SMILES for 2-methyloxasilinane;silicic acid is C[SiH]1CCCCO1.O[Si](O)(O)O.
What is the InChIKey of 2-methyloxasilinane;silicic acid?
The InChIKey is BDKPSSRIZWNZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12OSi.H4O4Si/c1-7-5-3-2-4-6-7;1-5(2,3)4/h7H,2-5H2,1H3;1-4H.
What are the key properties of 2-methyloxasilinane;silicic acid?
2-methyloxasilinane;silicic acid has a molecular weight of 212.35 g/mol, XLogP of -1.46, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxasilinane;silicic acid is sourced from PubChem (CID 173113818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).