About 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane
2-(1-chloropropyl)oxasilinane;2-methyloxasilinane (PubChem CID 174108121) has the molecular formula C12H27ClO2Si2
and a molecular weight of 294.97 g/mol. Its IUPAC name is 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane.
Molecular Properties
| Compound Name | 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane |
| PubChem CID | 174108121 |
| Molecular Formula | C12H27ClO2Si2 |
| Molecular Weight | 294.97 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane |
| SMILES | CCC(Cl)[SiH]1CCCCO1.C[SiH]1CCCCO1 |
| InChI | InChI=1S/C7H15ClOSi.C5H12OSi/c1-2-7(8)10-6-4-3-5-9-10;1-7-5-3-2-4-6-7/h7,10H,2-6H2,1H3;7H,2-5H2,1H3 |
| InChIKey | KQWJDYTWBXUYPX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.97 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane?
The IUPAC name of 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane (CID 174108121) is 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane.
What is the SMILES notation for 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane?
The canonical SMILES for 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane is CCC(Cl)[SiH]1CCCCO1.C[SiH]1CCCCO1.
What is the InChIKey of 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane?
The InChIKey is KQWJDYTWBXUYPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClOSi.C5H12OSi/c1-2-7(8)10-6-4-3-5-9-10;1-7-5-3-2-4-6-7/h7,10H,2-6H2,1H3;7H,2-5H2,1H3.
What are the key properties of 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane?
2-(1-chloropropyl)oxasilinane;2-methyloxasilinane has a molecular weight of 294.97 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloropropyl)oxasilinane;2-methyloxasilinane is sourced from PubChem (CID 174108121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).