C6H14O3Si — CID 173483101
1-(oxasilinan-2-yl)ethane-1,2-diol (PubChem CID 173483101) has the molecular formula C6H14O3Si and a molecular weight of 162.26 g/mol. Its IUPAC name is 1-(oxasilinan-2-yl)ethane-1,2-diol.
| Compound Name | 1-(oxasilinan-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 173483101 |
| Molecular Formula | C6H14O3Si |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1-(oxasilinan-2-yl)ethane-1,2-diol |
| SMILES | OCC(O)[SiH]1CCCCO1 |
| InChI | InChI=1S/C6H14O3Si/c7-5-6(8)10-4-2-1-3-9-10/h6-8,10H,1-5H2 |
| InChIKey | YCBMYMMIIISAKD-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|