C8H15F3OSi — CID 173009517
2-(3,4,4-trifluorobutan-2-yl)oxasilinane (PubChem CID 173009517) has the molecular formula C8H15F3OSi and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobutan-2-yl)oxasilinane.
| Compound Name | 2-(3,4,4-trifluorobutan-2-yl)oxasilinane |
|---|---|
| PubChem CID | 173009517 |
| Molecular Formula | C8H15F3OSi |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(3,4,4-trifluorobutan-2-yl)oxasilinane |
| SMILES | CC(C(F)C(F)F)[SiH]1CCCCO1 |
| InChI | InChI=1S/C8H15F3OSi/c1-6(7(9)8(10)11)13-5-3-2-4-12-13/h6-8,13H,2-5H2,1H3 |
| InChIKey | QRQDVAZHCUFATR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|