C11H16F8OSi — CID 173308842
2-(3,4,4,5,5,6,6,6-octafluoro-3-methylhexan-2-yl)oxasilinane (PubChem CID 173308842) has the molecular formula C11H16F8OSi and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-(3,4,4,5,5,6,6,6-octafluoro-3-methylhexan-2-yl)oxasilinane.
| Compound Name | 2-(3,4,4,5,5,6,6,6-octafluoro-3-methylhexan-2-yl)oxasilinane |
|---|---|
| PubChem CID | 173308842 |
| Molecular Formula | C11H16F8OSi |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-(3,4,4,5,5,6,6,6-octafluoro-3-methylhexan-2-yl)oxasilinane |
| SMILES | CC([SiH]1CCCCO1)C(C)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F8OSi/c1-7(21-6-4-3-5-20-21)8(2,12)9(13,14)10(15,16)11(17,18)19/h7,21H,3-6H2,1-2H3 |
| InChIKey | FZQJVDKNHUCKFK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|