C11H16F8O2Si — CID 173333370
3,4,4,5,5,6,6,6-octafluoro-2-methyl-1-(oxasilinan-2-yl)hexan-3-ol (PubChem CID 173333370) has the molecular formula C11H16F8O2Si and a molecular weight of 360.32 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,6-octafluoro-2-methyl-1-(oxasilinan-2-yl)hexan-3-ol.
| Compound Name | 3,4,4,5,5,6,6,6-octafluoro-2-methyl-1-(oxasilinan-2-yl)hexan-3-ol |
|---|---|
| PubChem CID | 173333370 |
| Molecular Formula | C11H16F8O2Si |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3,4,4,5,5,6,6,6-octafluoro-2-methyl-1-(oxasilinan-2-yl)hexan-3-ol |
| SMILES | CC(C[SiH]1CCCCO1)C(O)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F8O2Si/c1-7(6-22-5-3-2-4-21-22)8(12,20)9(13,14)10(15,16)11(17,18)19/h7,20,22H,2-6H2,1H3 |
| InChIKey | LBBYHNZGJNYAFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|