C14H27F3O2Si2 — CID 175187944
2-[3,4,4-trifluoro-2,3-dimethyl-1-(oxasilinan-2-yl)butan-2-yl]oxasilinane (PubChem CID 175187944) has the molecular formula C14H27F3O2Si2 and a molecular weight of 340.53 g/mol. Its IUPAC name is 2-[3,4,4-trifluoro-2,3-dimethyl-1-(oxasilinan-2-yl)butan-2-yl]oxasilinane.
| Compound Name | 2-[3,4,4-trifluoro-2,3-dimethyl-1-(oxasilinan-2-yl)butan-2-yl]oxasilinane |
|---|---|
| PubChem CID | 175187944 |
| Molecular Formula | C14H27F3O2Si2 |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[3,4,4-trifluoro-2,3-dimethyl-1-(oxasilinan-2-yl)butan-2-yl]oxasilinane |
| SMILES | CC(F)(C(F)F)C(C)(C[SiH]1CCCCO1)[SiH]1CCCCO1 |
| InChI | InChI=1S/C14H27F3O2Si2/c1-13(14(2,17)12(15)16,21-10-6-4-8-19-21)11-20-9-5-3-7-18-20/h12,20-21H,3-11H2,1-2H3 |
| InChIKey | WAQPLKLZBMQVQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|