C14H33NO2Si2 — CID 173231233
2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine (PubChem CID 173231233) has the molecular formula C14H33NO2Si2 and a molecular weight of 303.59 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine.
| Compound Name | 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 173231233 |
| Molecular Formula | C14H33NO2Si2 |
| Molecular Weight | 303.59 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine |
| SMILES | CCCC(N)[SiH]1CCCCO1.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C8H19NOSi.C6H14OSi/c1-2-5-8(9)11-7-4-3-6-10-11;1-8(2)6-4-3-5-7-8/h8,11H,2-7,9H2,1H3;3-6H2,1-2H3 |
| InChIKey | ZRAPCBKCOPJDDZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|