About 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine
2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine (PubChem CID 173231233) has the molecular formula C14H33NO2Si2
and a molecular weight of 303.59 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine |
| PubChem CID | 173231233 |
| Molecular Formula | C14H33NO2Si2 |
| Molecular Weight | 303.59 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine |
| SMILES | CCCC(N)[SiH]1CCCCO1.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C8H19NOSi.C6H14OSi/c1-2-5-8(9)11-7-4-3-6-10-11;1-8(2)6-4-3-5-7-8/h8,11H,2-7,9H2,1H3;3-6H2,1-2H3 |
| InChIKey | ZRAPCBKCOPJDDZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine?
The IUPAC name of 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine (CID 173231233) is 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine.
What is the SMILES notation for 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine?
The canonical SMILES for 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine is CCCC(N)[SiH]1CCCCO1.C[Si]1(C)CCCCO1.
What is the InChIKey of 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine?
The InChIKey is ZRAPCBKCOPJDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NOSi.C6H14OSi/c1-2-5-8(9)11-7-4-3-6-10-11;1-8(2)6-4-3-5-7-8/h8,11H,2-7,9H2,1H3;3-6H2,1-2H3.
What are the key properties of 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine?
2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine has a molecular weight of 303.59 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxasilinane;1-(oxasilinan-2-yl)butan-1-amine is sourced from PubChem (CID 173231233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).