C16H38O5Si5 — CID 173009343
2,2,4,4,6,6,8-heptamethyl-8-[3-(oxasilinan-2-yl)pent-4-enyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 173009343) has the molecular formula C16H38O5Si5 and a molecular weight of 450.91 g/mol. Its IUPAC name is 2,2,4,4,6,6,8-heptamethyl-8-[3-(oxasilinan-2-yl)pent-4-enyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4,4,6,6,8-heptamethyl-8-[3-(oxasilinan-2-yl)pent-4-enyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 173009343 |
| Molecular Formula | C16H38O5Si5 |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2,2,4,4,6,6,8-heptamethyl-8-[3-(oxasilinan-2-yl)pent-4-enyl]-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=CC(CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)[SiH]1CCCCO1 |
| InChI | InChI=1S/C16H38O5Si5/c1-9-16(22-14-11-10-13-17-22)12-15-26(8)20-24(4,5)18-23(2,3)19-25(6,7)21-26/h9,16,22H,1,10-15H2,2-8H3 |
| InChIKey | NAJDDVOCTNEGHR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|