C14H40Si6 — CID 14944193
1,1,2,2,3,3,4,4,5,5,6-undecamethyl-6-propylhexasilinane (PubChem CID 14944193) has the molecular formula C14H40Si6 and a molecular weight of 376.99 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecamethyl-6-propylhexasilinane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecamethyl-6-propylhexasilinane |
|---|---|
| PubChem CID | 14944193 |
| Molecular Formula | C14H40Si6 |
| Molecular Weight | 376.99 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecamethyl-6-propylhexasilinane |
| SMILES | CCC[Si]1(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C14H40Si6/c1-13-14-20(12)18(8,9)16(4,5)15(2,3)17(6,7)19(20,10)11/h13-14H2,1-12H3 |
| InChIKey | FAAZHRWFBLISML-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.99 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|