C10H28OSi4 — CID 173144809
1,1,2,2,3,3,4-heptamethyl-4-propoxytetrasiletane (PubChem CID 173144809) has the molecular formula C10H28OSi4 and a molecular weight of 276.68 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptamethyl-4-propoxytetrasiletane.
| Compound Name | 1,1,2,2,3,3,4-heptamethyl-4-propoxytetrasiletane |
|---|---|
| PubChem CID | 173144809 |
| Molecular Formula | C10H28OSi4 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1,1,2,2,3,3,4-heptamethyl-4-propoxytetrasiletane |
| SMILES | CCCO[Si]1(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C10H28OSi4/c1-9-10-11-15(8)13(4,5)12(2,3)14(15,6)7/h9-10H2,1-8H3 |
| InChIKey | DIKAIPSDKPYYFA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|