C35H70O10Si5 — CID 68657067
2,4,6,8,10-penta(cyclobutyl)-2,4,6,8,10-pentapropoxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 68657067) has the molecular formula C35H70O10Si5 and a molecular weight of 791.36 g/mol. Its IUPAC name is 2,4,6,8,10-penta(cyclobutyl)-2,4,6,8,10-pentapropoxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-penta(cyclobutyl)-2,4,6,8,10-pentapropoxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 68657067 |
| Molecular Formula | C35H70O10Si5 |
| Molecular Weight | 791.36 g/mol |
| Exact Mass | 790.38 |
| IUPAC Name | 2,4,6,8,10-penta(cyclobutyl)-2,4,6,8,10-pentapropoxy-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CCCO[Si]1(C2CCC2)O[Si](OCCC)(C2CCC2)O[Si](OCCC)(C2CCC2)O[Si](OCCC)(C2CCC2)O[Si](OCCC)(C2CCC2)O1 |
| InChI | InChI=1S/C35H70O10Si5/c1-6-26-36-46(31-16-11-17-31)41-47(37-27-7-2,32-18-12-19-32)43-49(39-29-9-4,34-22-14-23-34)45-50(40-30-10-5,35-24-15-25-35)44-48(42-46,38-28-8-3)33-20-13-21-33/h31-35H,6-30H2,1-5H3 |
| InChIKey | BGFYAJNYJNVRAZ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.36 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|