C8H18Br2Si2 — CID 163405857
1,3-dibromo-1,3-dipropyl-1,3-disiletane (PubChem CID 163405857) has the molecular formula C8H18Br2Si2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1,3-dibromo-1,3-dipropyl-1,3-disiletane.
| Compound Name | 1,3-dibromo-1,3-dipropyl-1,3-disiletane |
|---|---|
| PubChem CID | 163405857 |
| Molecular Formula | C8H18Br2Si2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 1,3-dibromo-1,3-dipropyl-1,3-disiletane |
| SMILES | CCC[Si]1(Br)C[Si](Br)(CCC)C1 |
| InChI | InChI=1S/C8H18Br2Si2/c1-3-5-11(9)7-12(10,8-11)6-4-2/h3-8H2,1-2H3 |
| InChIKey | XXTLVTZNGJYTEF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|