C6H20O4Si4 — CID 151043450
2,2-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 151043450) has the molecular formula C6H20O4Si4 and a molecular weight of 268.57 g/mol. Its IUPAC name is 2,2-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 151043450 |
| Molecular Formula | C6H20O4Si4 |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2,2-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(CCC)O[SiH2]O[SiH2]O[SiH2]O1 |
| InChI | InChI=1S/C6H20O4Si4/c1-3-5-14(6-4-2)9-12-7-11-8-13-10-14/h3-6,11-13H2,1-2H3 |
| InChIKey | MCONVMRFEDLWLH-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|