C12H33NO4Si4 — CID 154103709
N-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methyl]butan-1-amine (PubChem CID 154103709) has the molecular formula C12H33NO4Si4 and a molecular weight of 367.74 g/mol. Its IUPAC name is N-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methyl]butan-1-amine.
| Compound Name | N-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 154103709 |
| Molecular Formula | C12H33NO4Si4 |
| Molecular Weight | 367.74 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)methyl]butan-1-amine |
| SMILES | CCCCNC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H33NO4Si4/c1-9-10-11-13-12-21(8)16-19(4,5)14-18(2,3)15-20(6,7)17-21/h13H,9-12H2,1-8H3 |
| InChIKey | MCPAKAOJKXQUMX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|