C9H26O4S3Si4 — CID 174091789
[4-ethyl-2,4,6,8-tetramethyl-6,8-bis(sulfanylmethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]methanethiol (PubChem CID 174091789) has the molecular formula C9H26O4S3Si4 and a molecular weight of 406.85 g/mol. Its IUPAC name is [4-ethyl-2,4,6,8-tetramethyl-6,8-bis(sulfanylmethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]methanethiol.
| Compound Name | [4-ethyl-2,4,6,8-tetramethyl-6,8-bis(sulfanylmethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]methanethiol |
|---|---|
| PubChem CID | 174091789 |
| Molecular Formula | C9H26O4S3Si4 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [4-ethyl-2,4,6,8-tetramethyl-6,8-bis(sulfanylmethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]methanethiol |
| SMILES | CC[Si]1(C)O[Si](C)(CS)O[Si](C)(CS)O[Si](C)(CS)O1 |
| InChI | InChI=1S/C9H26O4S3Si4/c1-6-17(2)10-18(3,7-14)12-20(5,9-16)13-19(4,8-15)11-17/h14-16H,6-9H2,1-5H3 |
| InChIKey | MZVXYTGZQNJVAR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|