C14H38N2O4Si4 — CID 155623529
2-N,2-N,4-N,4-N-tetraethyl-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane-2,4-diamine (PubChem CID 155623529) has the molecular formula C14H38N2O4Si4 and a molecular weight of 410.81 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetraethyl-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetraethyl-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane-2,4-diamine |
|---|---|
| PubChem CID | 155623529 |
| Molecular Formula | C14H38N2O4Si4 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetraethyl-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane-2,4-diamine |
| SMILES | CCN(CC)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(N(CC)CC)O1 |
| InChI | InChI=1S/C14H38N2O4Si4/c1-11-15(12-2)23(9)18-21(5,6)17-22(7,8)19-24(10,20-23)16(13-3)14-4/h11-14H2,1-10H3 |
| InChIKey | JCBYNQPWQSINDL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|