C11H30O8Si4 — CID 175254771
2,4,6,8-tetraethoxy-2-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 175254771) has the molecular formula C11H30O8Si4 and a molecular weight of 402.70 g/mol. Its IUPAC name is 2,4,6,8-tetraethoxy-2-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetraethoxy-2-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 175254771 |
| Molecular Formula | C11H30O8Si4 |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2,4,6,8-tetraethoxy-2-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(OCC)O[SiH](OCC)O[SiH](OCC)O[SiH](OCC)O1 |
| InChI | InChI=1S/C11H30O8Si4/c1-6-11-23(15-10-5)18-21(13-8-3)16-20(12-7-2)17-22(19-23)14-9-4/h20-22H,6-11H2,1-5H3 |
| InChIKey | AJNNNFQPBDJQGW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|