C13H29NO2SSi — CID 151930485
3-(6-butyl-2-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol (PubChem CID 151930485) has the molecular formula C13H29NO2SSi and a molecular weight of 291.53 g/mol. Its IUPAC name is 3-(6-butyl-2-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol.
| Compound Name | 3-(6-butyl-2-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 151930485 |
| Molecular Formula | C13H29NO2SSi |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-(6-butyl-2-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol |
| SMILES | CCCCC1CCO[Si](CC)(CCCS)ONC1 |
| InChI | InChI=1S/C13H29NO2SSi/c1-3-5-7-13-8-9-15-18(4-2,11-6-10-17)16-14-12-13/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | SYRJAIUOWRHDFO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|