C15H30O3SSi — CID 155634280
S-[3-(2,4-dimethyl-1,3,2-dioxasilolan-2-yl)propyl] octanethioate (PubChem CID 155634280) has the molecular formula C15H30O3SSi and a molecular weight of 318.56 g/mol. Its IUPAC name is S-[3-(2,4-dimethyl-1,3,2-dioxasilolan-2-yl)propyl] octanethioate.
| Compound Name | S-[3-(2,4-dimethyl-1,3,2-dioxasilolan-2-yl)propyl] octanethioate |
|---|---|
| PubChem CID | 155634280 |
| Molecular Formula | C15H30O3SSi |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | S-[3-(2,4-dimethyl-1,3,2-dioxasilolan-2-yl)propyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCCC[Si]1(C)OCC(C)O1 |
| InChI | InChI=1S/C15H30O3SSi/c1-4-5-6-7-8-10-15(16)19-11-9-12-20(3)17-13-14(2)18-20/h14H,4-13H2,1-3H3 |
| InChIKey | LUQNLVWOYADHAJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|