About S-octyl undec-10-enethioate
S-octyl undec-10-enethioate (PubChem CID 101446304) has the molecular formula C19H36OS
and a molecular weight of 312.56 g/mol. Its IUPAC name is S-octyl undec-10-enethioate.
Molecular Properties
| Compound Name | S-octyl undec-10-enethioate |
| PubChem CID | 101446304 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | S-octyl undec-10-enethioate |
| SMILES | C=CCCCCCCCCC(=O)SCCCCCCCC |
| InChI | InChI=1S/C19H36OS/c1-3-5-7-9-11-12-13-15-17-19(20)21-18-16-14-10-8-6-4-2/h3H,1,4-18H2,2H3 |
| InChIKey | SPEGXLBIKWDHTP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octyl undec-10-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octyl undec-10-enethioate?
The IUPAC name of S-octyl undec-10-enethioate (CID 101446304) is S-octyl undec-10-enethioate.
What is the SMILES notation for S-octyl undec-10-enethioate?
The canonical SMILES for S-octyl undec-10-enethioate is C=CCCCCCCCCC(=O)SCCCCCCCC.
What is the InChIKey of S-octyl undec-10-enethioate?
The InChIKey is SPEGXLBIKWDHTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36OS/c1-3-5-7-9-11-12-13-15-17-19(20)21-18-16-14-10-8-6-4-2/h3H,1,4-18H2,2H3.
What are the key properties of S-octyl undec-10-enethioate?
S-octyl undec-10-enethioate has a molecular weight of 312.56 g/mol, XLogP of 6.91, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-octyl undec-10-enethioate is sourced from PubChem (CID 101446304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).