C6H12O3 — CID 10701862
(2R,3S)-2,3-diethoxyoxirane (PubChem CID 10701862) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R,3S)-2,3-diethoxyoxirane.
| Compound Name | (2R,3S)-2,3-diethoxyoxirane |
|---|---|
| PubChem CID | 10701862 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2R,3S)-2,3-diethoxyoxirane |
| SMILES | CCO[C@@H]1O[C@@H]1OCC |
| InChI | InChI=1S/C6H12O3/c1-3-7-5-6(9-5)8-4-2/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | AMTTVTLMJJQDRN-OLQVQODUSA-N |
| XLogP | 0.74 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|