C6H12O4 — CID 59986645
3,4-diethoxydioxetane (PubChem CID 59986645) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 3,4-diethoxydioxetane.
| Compound Name | 3,4-diethoxydioxetane |
|---|---|
| PubChem CID | 59986645 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 3,4-diethoxydioxetane |
| SMILES | CCOC1OOC1OCC |
| InChI | InChI=1S/C6H12O4/c1-3-7-5-6(8-4-2)10-9-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | FQUFMHJWNHNACO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|