C3H12O4Si3 — CID 123910397
4,4-dimethyl-1,3,5,7,2,4,6-tetraoxatrisilocane (PubChem CID 123910397) has the molecular formula C3H12O4Si3 and a molecular weight of 196.38 g/mol. Its IUPAC name is 4,4-dimethyl-1,3,5,7,2,4,6-tetraoxatrisilocane.
| Compound Name | 4,4-dimethyl-1,3,5,7,2,4,6-tetraoxatrisilocane |
|---|---|
| PubChem CID | 123910397 |
| Molecular Formula | C3H12O4Si3 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 4,4-dimethyl-1,3,5,7,2,4,6-tetraoxatrisilocane |
| SMILES | C[Si]1(C)O[SiH2]OCO[SiH2]O1 |
| InChI | InChI=1S/C3H12O4Si3/c1-10(2)6-8-4-3-5-9-7-10/h3,8-9H2,1-2H3 |
| InChIKey | NCNSJEAMIJNBJI-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|