C10H22O4SSi — CID 175099563
2,2,6-triethoxyoxasilinane-6-thiol (PubChem CID 175099563) has the molecular formula C10H22O4SSi and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,2,6-triethoxyoxasilinane-6-thiol.
| Compound Name | 2,2,6-triethoxyoxasilinane-6-thiol |
|---|---|
| PubChem CID | 175099563 |
| Molecular Formula | C10H22O4SSi |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2,2,6-triethoxyoxasilinane-6-thiol |
| SMILES | CCOC1(S)CCC[Si](OCC)(OCC)O1 |
| InChI | InChI=1S/C10H22O4SSi/c1-4-11-10(15)8-7-9-16(14-10,12-5-2)13-6-3/h15H,4-9H2,1-3H3 |
| InChIKey | SADLXRUTMIYHSQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|