About 2,2-dichloro-6,6-diethoxyoxasilinane
2,2-dichloro-6,6-diethoxyoxasilinane (PubChem CID 66904914) has the molecular formula C8H16Cl2O3Si
and a molecular weight of 259.20 g/mol. Its IUPAC name is 2,2-dichloro-6,6-diethoxyoxasilinane.
Molecular Properties
| Compound Name | 2,2-dichloro-6,6-diethoxyoxasilinane |
| PubChem CID | 66904914 |
| Molecular Formula | C8H16Cl2O3Si |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2,2-dichloro-6,6-diethoxyoxasilinane |
| SMILES | CCOC1(OCC)CCC[Si](Cl)(Cl)O1 |
| InChI | InChI=1S/C8H16Cl2O3Si/c1-3-11-8(12-4-2)6-5-7-14(9,10)13-8/h3-7H2,1-2H3 |
| InChIKey | ZLDKJWDUZDGQND-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-6,6-diethoxyoxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-6,6-diethoxyoxasilinane?
The IUPAC name of 2,2-dichloro-6,6-diethoxyoxasilinane (CID 66904914) is 2,2-dichloro-6,6-diethoxyoxasilinane.
What is the SMILES notation for 2,2-dichloro-6,6-diethoxyoxasilinane?
The canonical SMILES for 2,2-dichloro-6,6-diethoxyoxasilinane is CCOC1(OCC)CCC[Si](Cl)(Cl)O1.
What is the InChIKey of 2,2-dichloro-6,6-diethoxyoxasilinane?
The InChIKey is ZLDKJWDUZDGQND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Cl2O3Si/c1-3-11-8(12-4-2)6-5-7-14(9,10)13-8/h3-7H2,1-2H3.
What are the key properties of 2,2-dichloro-6,6-diethoxyoxasilinane?
2,2-dichloro-6,6-diethoxyoxasilinane has a molecular weight of 259.20 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-6,6-diethoxyoxasilinane is sourced from PubChem (CID 66904914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).