C8H16Cl2O3Si — CID 66904914
2,2-dichloro-6,6-diethoxyoxasilinane (PubChem CID 66904914) has the molecular formula C8H16Cl2O3Si and a molecular weight of 259.20 g/mol. Its IUPAC name is 2,2-dichloro-6,6-diethoxyoxasilinane.
| Compound Name | 2,2-dichloro-6,6-diethoxyoxasilinane |
|---|---|
| PubChem CID | 66904914 |
| Molecular Formula | C8H16Cl2O3Si |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 2,2-dichloro-6,6-diethoxyoxasilinane |
| SMILES | CCOC1(OCC)CCC[Si](Cl)(Cl)O1 |
| InChI | InChI=1S/C8H16Cl2O3Si/c1-3-11-8(12-4-2)6-5-7-14(9,10)13-8/h3-7H2,1-2H3 |
| InChIKey | ZLDKJWDUZDGQND-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|